The math optional, made finite. Daily Practice

Properties of Laplace transform (linearity, shift, derivative, convolution)

At a Glance

Why This Chapter Matters

Laplace-transform properties have appeared in Paper 1 in three distinct flavours, each testing a different rule. The 2025 convolution theorem question (15 marks) requires a two-part answer: prove the theorem by Fubini and then solve a Volterra integral equation. The 2023 question (10 marks) uses the L{f(t)/t}\mathcal{L}\{f(t)/t\} integral property to evaluate a classical improper integral in four lines. The 2020 question (10 marks) applies L{tf}=F(s)\mathcal{L}\{tf\}=-F'(s) to a variable-coefficient ODE, producing a first-order ODE in Y(s)Y(s). Each archetype recycles one property cold — the proof structure is nearly mechanical once you know which rule to invoke.

Minimum Theory

Standard transform pairs (for reference).

L{1}=1s,L{tn}=n!sn+1,L{eat}=1sa,L{sinat}=as2+a2,L{cosat}=ss2+a2.\mathcal{L}\{1\} = \frac{1}{s},\qquad \mathcal{L}\{t^n\} = \frac{n!}{s^{n+1}},\qquad \mathcal{L}\{e^{at}\} = \frac{1}{s-a},\qquad \mathcal{L}\{\sin at\} = \frac{a}{s^2+a^2},\qquad \mathcal{L}\{\cos at\} = \frac{s}{s^2+a^2}.

Derivative rule. L{y}=sYy(0)\mathcal{L}\{y'\}=sY-y(0); L{y}=s2Ysy(0)y(0)\mathcal{L}\{y''\}=s^2Y-sy(0)-y'(0).

Multiplication by tt rule. If L{f(t)}=F(s)\mathcal{L}\{f(t)\}=F(s), then L{tf(t)}=F(s)=dF/ds\mathcal{L}\{t\,f(t)\}=-F'(s)=-dF/ds. More generally, L{tnf(t)}=(1)nF(n)(s)\mathcal{L}\{t^n f(t)\}=(-1)^n F^{(n)}(s).

Division by tt rule. L{f(t)/t}=sF(p)dp\mathcal{L}\{f(t)/t\}=\displaystyle\int_s^\infty F(p)\,dp, provided limt0+f(t)/t\lim_{t\to0^+}f(t)/t exists. Equivalently, 0f(t)/tdt=0F(p)dp\displaystyle\int_0^\infty f(t)/t\,dt=\int_0^\infty F(p)\,dp (Frullani form, obtained by setting s=0s=0).

Convolution theorem. Define the convolution (fg)(t)=0tf(x)g(tx)dx(f*g)(t)=\displaystyle\int_0^t f(x)g(t-x)\,dx. Then L{fg}=F(s)G(s)\mathcal{L}\{f*g\}=F(s)G(s).

Question Archetypes

ArchetypeYou are seeing this when…
convolution-theoremProve L{fg}=FG\mathcal{L}\{f*g\}=FG and/or solve a Volterra integral equation
laplace-integral-propertyProve/use the 0f(t)/tdt=0F(p)dp\int_0^\infty f(t)/t\,dt=\int_0^\infty F(p)\,dp identity to evaluate a definite integral
laplace-variable-coefficientVariable-coefficient ODE (factor of tt multiplying yy'' or yy'); use L{tf}=F(s)\mathcal{L}\{tf\}=-F'(s)

convolution-theorem (1 question(s); 2025)

Recognition Cues

Solution Template

Proof:

  1. Write L{(fg)(t)}=0est0tf(x)g(tx)dxdt\mathcal{L}\{(f*g)(t)\}=\int_0^\infty e^{-st}\int_0^t f(x)g(t-x)\,dx\,dt.
  2. Interchange the order of integration over the region 0xt<0\leq x\leq t<\infty: outer integral over xx from 00 to \infty, inner from t=xt=x to \infty.
  3. Substitute τ=tx\tau=t-x in the inner integral: xestg(tx)dt=esx0esτg(τ)dτ=esxG(s)\int_x^\infty e^{-st}g(t-x)\,dt=e^{-sx}\int_0^\infty e^{-s\tau}g(\tau)\,d\tau=e^{-sx}G(s).
  4. Collect: F(s)G(s)F(s)\cdot G(s).

Solving a Volterra integral equation:

  1. Take L\mathcal{L} of both sides.
  2. Apply the convolution theorem to the integral term.
  3. Solve the algebraic equation for Y(s)Y(s).
  4. Invert Y(s)Y(s) (partial fractions if needed).

Worked Example

2025 Paper 1, 2025-P1-Q6a (15 marks)

If F(s)F(s) and G(s)G(s) are Laplace transforms of f(t)f(t) and g(t)g(t), prove L ⁣(0tf(x)g(tx)dx)=F(s)G(s)\mathcal{L}\!\left(\int_0^t f(x)g(t-x)\,dx\right)=F(s)G(s). Hence solve y(t)=t+0ty(x)sin(tx)dxy(t)=t+\int_0^t y(x)\sin(t-x)\,dx.

Part 1 — Proof.

L ⁣(0tf(x)g(tx)dx)=0est ⁣(0tf(x)g(tx)dx)dt.\mathcal{L}\!\left(\int_0^t f(x)g(t-x)\,dx\right) = \int_0^\infty e^{-st}\!\left(\int_0^t f(x)g(t-x)\,dx\right)dt.

Region: 0xt<0\leq x\leq t<\infty. Interchange (Fubini, valid since both transforms exist absolutely):

=0f(x) ⁣(xestg(tx)dt)dx.= \int_0^\infty f(x)\!\left(\int_x^\infty e^{-st}g(t-x)\,dt\right)dx.

Inner integral: substitute τ=tx\tau=t-x:

xestg(tx)dt=esx0esτg(τ)dτ=esxG(s).\int_x^\infty e^{-st}g(t-x)\,dt = e^{-sx}\int_0^\infty e^{-s\tau}g(\tau)\,d\tau = e^{-sx}G(s).

Therefore:

L ⁣(0tf(x)g(tx)dx)=0f(x)esxdxG(s)=F(s)G(s).\mathcal{L}\!\left(\int_0^t f(x)g(t-x)\,dx\right) = \int_0^\infty f(x)e^{-sx}\,dx\cdot G(s) = F(s)G(s).\qquad\blacksquare

Part 2 — Solve the integral equation.

The equation y(t)=t+(ysin)(t)y(t)=t+(y*\sin)(t) transforms to:

Y(s)=1s2+Y(s)1s2+1.Y(s) = \frac{1}{s^2} + Y(s)\cdot\frac{1}{s^2+1}.

Solve for Y(s)Y(s):

Y(s) ⁣(11s2+1)=1s2Y(s)s2s2+1=1s2Y(s)=s2+1s4=1s2+1s4.Y(s)\!\left(1-\frac{1}{s^2+1}\right) = \frac{1}{s^2} \qquad\Longrightarrow\qquad Y(s)\cdot\frac{s^2}{s^2+1} = \frac{1}{s^2} \qquad\Longrightarrow\qquad Y(s) = \frac{s^2+1}{s^4} = \frac{1}{s^2}+\frac{1}{s^4}.

Invert:

y(t)=L1 ⁣{1s2}+L1 ⁣{1s4}=t+t33!=t+t36.y(t) = \mathcal{L}^{-1}\!\left\{\frac{1}{s^2}\right\} + \mathcal{L}^{-1}\!\left\{\frac{1}{s^4}\right\} = t + \frac{t^3}{3!} = t+\frac{t^3}{6}.

  y(t)=t+t36.  \boxed{\;y(t) = t+\frac{t^3}{6}.\;}

Common Traps


laplace-integral-property (1 question(s); 2023)

Recognition Cues

Solution Template

  1. Prove the identity. Write 0F(p)dp=00eptf(t)dtdp\int_0^\infty F(p)\,dp=\int_0^\infty\int_0^\infty e^{-pt}f(t)\,dt\,dp; interchange (Fubini); inner integral 0eptdp=1/t\int_0^\infty e^{-pt}\,dp=1/t.
  2. Compute F(p)F(p) for the given f(t)f(t) using standard transforms.
  3. Integrate F(p)F(p) from 00 to \infty. For differences of exponentials: F(p)=1/(p+a)1/(p+b)F(p)=1/(p+a)-1/(p+b); antiderivative is ln(p+a)ln(p+b)\ln(p+a)-\ln(p+b); evaluate at limits.

Worked Example

2023 Paper 1, 2023-P1-Q5b (10 marks)

Given L{f(t);p}=F(p)\mathcal{L}\{f(t);p\}=F(p), show 0f(t)/tdt=0F(p)dp\int_0^\infty f(t)/t\,dt=\int_0^\infty F(p)\,dp. Hence evaluate 0(ete3t)/tdt\int_0^\infty(e^{-t}-e^{-3t})/t\,dt.

Step 1 — Prove the identity.

0F(p)dp=00eptf(t)dtdp.\int_0^\infty F(p)\,dp = \int_0^\infty\int_0^\infty e^{-pt}f(t)\,dt\,dp.

Interchange the order of integration (Fubini, valid since f(t)/tf(t)/t is integrable):

=0f(t) ⁣[0eptdp]dt=0f(t)1tdt.= \int_0^\infty f(t)\!\left[\int_0^\infty e^{-pt}\,dp\right]dt = \int_0^\infty f(t)\cdot\frac{1}{t}\,dt. \qquad\blacksquare

(The inner integral: 0eptdp=[ept/t]0=1/t\int_0^\infty e^{-pt}\,dp = \bigl[-e^{-pt}/t\bigr]_0^\infty = 1/t for t>0t>0.)

Step 2 — Apply to f(t)=ete3tf(t)=e^{-t}-e^{-3t}.

F(p)=L{et}L{e3t}=1p+11p+3.F(p) = \mathcal{L}\{e^{-t}\}-\mathcal{L}\{e^{-3t}\} = \frac{1}{p+1}-\frac{1}{p+3}.

By the identity:

0ete3ttdt=0 ⁣(1p+11p+3)dp=[ln(p+1)ln(p+3)]0.\int_0^\infty\frac{e^{-t}-e^{-3t}}{t}\,dt = \int_0^\infty\!\left(\frac{1}{p+1}-\frac{1}{p+3}\right)dp = \Big[\ln(p+1)-\ln(p+3)\Big]_0^\infty.

At p=p=\infty: lnp+1p+3ln1=0\ln\frac{p+1}{p+3}\to\ln 1=0. At p=0p=0: ln13=ln3\ln\frac{1}{3}=-\ln 3.

0ete3ttdt=0(ln3)=ln3.\int_0^\infty\frac{e^{-t}-e^{-3t}}{t}\,dt = 0-(-\ln 3) = \ln 3.

  0ete3ttdt=ln3.  \boxed{\;\int_0^\infty\frac{e^{-t}-e^{-3t}}{t}\,dt = \ln 3.\;}

Common Traps


laplace-variable-coefficient (1 question(s); 2020)

Recognition Cues

Solution Template

  1. Write Y(s)=L{y}Y(s)=\mathcal{L}\{y\}. State the initial conditions.
  2. Transform each term using L{y}=sYy(0)\mathcal{L}\{y'\}=sY-y(0), L{y}=s2Ysy(0)y(0)\mathcal{L}\{y''\}=s^2Y-sy(0)-y'(0), and L{tf}=d/ds[L{f}]\mathcal{L}\{tf\}=-d/ds[\mathcal{L}\{f\}].
  3. Assemble the subsidiary equation in YY and Y=dY/dsY'=dY/ds. It will be a first-order linear ODE in Y(s)Y(s).
  4. Solve with an integrating factor.
  5. Partial-fraction decompose Y(s)Y(s).
  6. Invert using standard pairs.
  7. Discuss uniqueness if asked: if y(0)y'(0) dropped out, the solution carries a free constant regardless of the initial slope — the ODE has a singular point at the initial time.

Worked Example

2020 Paper 1, 2020-P1-Q7b (10 marks)

Using Laplace transform, solve ty+2ty+2y=2ty''+2ty'+2y=2; y(0)=1y(0)=1, y(0)y'(0) arbitrary. Does this problem have a unique solution?

Let Y(s)=L{y}Y(s)=\mathcal{L}\{y\}, y(0)=1y(0)=1, y(0)=ay'(0)=a (left free).

Step 1 — Transform each term.

L{ty}=dds(s2Ysa)=(2sY+s2Y1),\mathcal{L}\{ty''\} = -\frac{d}{ds}(s^2Y-s-a) = -(2sY+s^2Y'-1),

L{2ty}=2dds(sY1)=2(Y+sY),\mathcal{L}\{2ty'\} = -2\frac{d}{ds}(sY-1) = -2(Y+sY'),

L{2y}=2Y,L{2}=2s.\mathcal{L}\{2y\} = 2Y, \qquad \mathcal{L}\{2\} = \frac{2}{s}.

Step 2 — Assemble.

(2sY+s2Y1)2(Y+sY)+2Y=2s.-(2sY+s^2Y'-1) - 2(Y+sY') + 2Y = \frac{2}{s}.

s2Y2sY+12sY2Y+2Y=2s.-s^2Y' - 2sY + 1 - 2sY' - 2Y + 2Y = \frac{2}{s}.

Note the aa term from y(0)y'(0) cancelled. Simplify and multiply by 1-1:

(s2+2s)Y+2sY=12s.()(s^2+2s)Y' + 2sY = 1 - \frac{2}{s}.\quad(\ast)

Step 3 — Solve as a first-order ODE in YY. Rewrite:

Y+2s+2Y=s2s2(s+2).Y' + \frac{2}{s+2}Y = \frac{s-2}{s^2(s+2)}.

Integrating factor: μ=(s+2)2\mu=(s+2)^2. Then:

dds ⁣[(s+2)2Y]=(s+2)(s2)s2=s24s2=14s2.\frac{d}{ds}\!\big[(s+2)^2Y\big] = \frac{(s+2)(s-2)}{s^2} = \frac{s^2-4}{s^2} = 1 - \frac{4}{s^2}.

Integrate:

(s+2)2Y=s+4s+C1.(s+2)^2Y = s + \frac{4}{s} + C_1.

Y(s)=s2+C1s+4s(s+2)2.Y(s) = \frac{s^2+C_1 s+4}{s(s+2)^2}.

Step 4 — Partial fractions.

Y(s)=1s+C(s+2)2,C=C14 (arbitrary).Y(s) = \frac{1}{s} + \frac{C}{(s+2)^2}, \qquad C = C_1-4 \text{ (arbitrary)}.

Step 5 — Invert.

  y(t)=1+Cte2t,C arbitrary.  \boxed{\;y(t) = 1 + C\,t\,e^{-2t},\quad C\text{ arbitrary}.\;}

Step 6 — Uniqueness. The arbitrary constant CC cannot be fixed because y(0)=Cy'(0)=C (which was left free, and dropped from the equation). The coefficient of yy'' vanishes at t=0t=0 — a regular singular point — so standard existence-uniqueness does not apply: specifying only y(0)y(0) does not determine a unique solution.

  The solution is NOT unique.  \boxed{\;\text{The solution is NOT unique.}\;}

Verify: y=C(12t)e2ty'=C(1-2t)e^{-2t}, y=C(4t4)e2ty''=C(4t-4)e^{-2t}. Then ty+2ty+2y=Ce2t[t(4t4)+2t(12t)+2t]+2=0+2=2ty''+2ty'+2y=Ce^{-2t}[t(4t-4)+2t(1-2t)+2t]+2=0+2=2 ✓.

Common Traps


Marks-Aware Writing

10-mark questions (2023, 2020): For the integral-property question (2023): the proof via Fubini (3 marks) and the evaluation of the definite integral (7 marks). For the variable-coefficient question (2020): setting up the transformed ODE ()(\ast) (4 marks), solving it with integrating factor (3 marks), inverting (2 marks), uniqueness discussion (1 mark).

15-mark question (2025): Part 1 (proof, 6–7 marks): state Fubini, write the interchange, the τ=tx\tau=t-x substitution, and the conclusion. Part 2 (integral equation, 7–8 marks): take transform, apply convolution theorem, solve for YY, invert. Missing the proof of the theorem costs all Part 1 marks; a correct Part 2 without invoking Part 1 earns partial credit.

Practice Set

YearPaper/QMarksOne-line hint
2024P1-Q5b10Standard Laplace property application; identify which rule applies
2024P1-Q8a15Laplace + convolution or shift; identify the structure first
2023P1-Q8a15State and use the convolution theorem; solve algebraically for YY
2022P1-Q7b15Variable coefficient ODE; L{tf}=F(s)\mathcal{L}\{tf\}=-F'(s); integrating factor in ss
2021P1-Q5b10Integral property or shift theorem; verify Fubini conditions
2017P1-Q8b17Laplace transform + shift; solve the resulting algebraic equation
2015P1-Q7a-i6Evaluate a specific transform using standard pairs and shift
2014P1-Q8c20Multi-step Laplace: transform, solve, invert using partial fractions
2013P1-Q6d15Solve IVP via Laplace transform; apply derivative rules carefully

We've mapped all 13 years of this exam. Get new chapters, tools, and solutions as we release them — free.